C13H13Cl2N5O — CID 47061417
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide (PubChem CID 47061417) has the molecular formula C13H13Cl2N5O and a molecular weight of 326.19 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 47061417 |
| Molecular Formula | C13H13Cl2N5O |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-2-methylpyrimidine-4-carboxamide |
| SMILES | Cc1nccc(C(=O)NCCNc2ncc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H13Cl2N5O/c1-8-16-3-2-11(20-8)13(21)18-5-4-17-12-10(15)6-9(14)7-19-12/h2-3,6-7H,4-5H2,1H3,(H,17,19)(H,18,21) |
| InChIKey | ITAZRSQXNXQTSB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|