C15H17Cl2N5O — CID 86991618
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-6-(dimethylamino)pyridine-3-carboxamide (PubChem CID 86991618) has the molecular formula C15H17Cl2N5O and a molecular weight of 354.24 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-6-(dimethylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-6-(dimethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86991618 |
| Molecular Formula | C15H17Cl2N5O |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-6-(dimethylamino)pyridine-3-carboxamide |
| SMILES | CN(C)c1ccc(C(=O)NCCNc2ncc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C15H17Cl2N5O/c1-22(2)13-4-3-10(8-20-13)15(23)19-6-5-18-14-12(17)7-11(16)9-21-14/h3-4,7-9H,5-6H2,1-2H3,(H,18,21)(H,19,23) |
| InChIKey | VMJAXIINQJUDSL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|