C17H16Cl2N4O3 — CID 74380686
4-chloro-N-[2-[[3-chloro-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 74380686) has the molecular formula C17H16Cl2N4O3 and a molecular weight of 395.25 g/mol. Its IUPAC name is 4-chloro-N-[2-[[3-chloro-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[3-chloro-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 74380686 |
| Molecular Formula | C17H16Cl2N4O3 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 4-chloro-N-[2-[[3-chloro-5-[3-(hydroxyamino)-3-oxoprop-1-enyl]-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | O=C(C=Cc1cnc(NCCNC(=O)c2ccc(Cl)cc2)c(Cl)c1)NO |
| InChI | InChI=1S/C17H16Cl2N4O3/c18-13-4-2-12(3-5-13)17(25)21-8-7-20-16-14(19)9-11(10-22-16)1-6-15(24)23-26/h1-6,9-10,26H,7-8H2,(H,20,22)(H,21,25)(H,23,24) |
| InChIKey | HUBCZQUAHLUBQM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|