C20H20ClN3O3 — CID 35004982
N-[2-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]ethyl]-4-chlorobenzamide (PubChem CID 35004982) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-[2-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]ethyl]-4-chlorobenzamide.
| Compound Name | N-[2-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]ethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 35004982 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[2-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]ethyl]-4-chlorobenzamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)NCCNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-14(25)24-18-9-2-15(3-10-18)4-11-19(26)22-12-13-23-20(27)16-5-7-17(21)8-6-16/h2-11H,12-13H2,1H3,(H,22,26)(H,23,27)(H,24,25)/b11-4+ |
| InChIKey | ZUZGAFXRPBAKIK-NYYWCZLTSA-N |
| XLogP | 2.86 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|