C19H19N3O3 — CID 134040656
4-[(E)-3-(4-acetamidoanilino)-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 134040656) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[(E)-3-(4-acetamidoanilino)-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-(4-acetamidoanilino)-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 134040656 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[(E)-3-(4-acetamidoanilino)-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)Nc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-13(23)21-16-8-10-17(11-9-16)22-18(24)12-5-14-3-6-15(7-4-14)19(25)20-2/h3-12H,1-2H3,(H,20,25)(H,21,23)(H,22,24)/b12-5+ |
| InChIKey | IJFUIWBVDARXNH-LFYBBSHMSA-N |
| XLogP | 2.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|