C12H14N2O2 — CID 47142125
(E)-3-(4-acetamidophenyl)-N-methylprop-2-enamide (PubChem CID 47142125) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (E)-3-(4-acetamidophenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-(4-acetamidophenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 47142125 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (E)-3-(4-acetamidophenyl)-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C12H14N2O2/c1-9(15)14-11-6-3-10(4-7-11)5-8-12(16)13-2/h3-8H,1-2H3,(H,13,16)(H,14,15)/b8-5+ |
| InChIKey | UKDKNNSGPSHMMS-VMPITWQZSA-N |
| XLogP | 1.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|