C10H11NO3 — CID 14989749
(E)-3-(3,4-dihydroxyphenyl)-N-methylprop-2-enamide (PubChem CID 14989749) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 14989749 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H11NO3/c1-11-10(14)5-3-7-2-4-8(12)9(13)6-7/h2-6,12-13H,1H3,(H,11,14)/b5-3+ |
| InChIKey | BRWJVYQGQPRRCV-HWKANZROSA-N |
| XLogP | 0.86 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|