C16H15NO6 — CID 54121370
3-(3,4-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enamide (PubChem CID 54121370) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 54121370 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-N-[(2,3,4-trihydroxyphenyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)NCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C16H15NO6/c18-11-4-1-9(7-13(11)20)2-6-14(21)17-8-10-3-5-12(19)16(23)15(10)22/h1-7,18-20,22-23H,8H2,(H,17,21) |
| InChIKey | NNXJYERLMOUIRH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|