C13H17NO3 — CID 15086373
(E)-N-butyl-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 15086373) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (E)-N-butyl-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-butyl-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 15086373 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (E)-N-butyl-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | CCCCNC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H17NO3/c1-2-3-8-14-13(17)7-5-10-4-6-11(15)12(16)9-10/h4-7,9,15-16H,2-3,8H2,1H3,(H,14,17)/b7-5+ |
| InChIKey | HWCLPNBZZHKVDI-FNORWQNLSA-N |
| XLogP | 2.03 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|