C25H31N3O6 — CID 176514699
(E)-N-[4-[3-aminopropyl-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 176514699) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is (E)-N-[4-[3-aminopropyl-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[3-aminopropyl-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 176514699 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | (E)-N-[4-[3-aminopropyl-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]butyl]-3-(3,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | NCCCN(CCCCNC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H31N3O6/c26-12-3-15-28(25(34)11-7-19-5-9-21(30)23(32)17-19)14-2-1-13-27-24(33)10-6-18-4-8-20(29)22(31)16-18/h4-11,16-17,29-32H,1-3,12-15,26H2,(H,27,33)/b10-6+,11-7+ |
| InChIKey | AIDAJRBVRIFHAY-JMQWPVDRSA-N |
| XLogP | 2.31 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|