C34H37N3O5 — CID 171647487
(E)-N-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]-3-phenylprop-2-enamide (PubChem CID 171647487) has the molecular formula C34H37N3O5 and a molecular weight of 567.69 g/mol. Its IUPAC name is (E)-N-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171647487 |
| Molecular Formula | C34H37N3O5 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (E)-N-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-[3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]amino]butyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCCCN(CCCNC(=O)/C=C/c1ccc(O)cc1)C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C34H37N3O5/c38-30-16-9-28(10-17-30)14-21-33(41)36-24-6-26-37(34(42)22-15-29-11-18-31(39)19-12-29)25-5-4-23-35-32(40)20-13-27-7-2-1-3-8-27/h1-3,7-22,38-39H,4-6,23-26H2,(H,35,40)(H,36,41)/b20-13+,21-14+,22-15+ |
| InChIKey | HMNKLJCBBPNMIG-LHHAKPDNSA-N |
| XLogP | 4.77 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|