C17H27ClN2O2 — CID 11045649
8-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]octylazanium chloride (PubChem CID 11045649) has the molecular formula C17H27ClN2O2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 8-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]octylazanium chloride.
| Compound Name | 8-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]octylazanium chloride |
|---|---|
| PubChem CID | 11045649 |
| Molecular Formula | C17H27ClN2O2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 8-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]octylazanium chloride |
| SMILES | [Cl-].[NH3+]CCCCCCCCNC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C17H26N2O2.ClH/c18-13-5-3-1-2-4-6-14-19-17(21)12-9-15-7-10-16(20)11-8-15;/h7-12,20H,1-6,13-14,18H2,(H,19,21);1H/b12-9+; |
| InChIKey | YHCXAIBVACPXDX-NBYYMMLRSA-N |
| XLogP | -0.89 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|