C26H30F2N2O2 — CID 5142775
3-(4-fluorophenyl)-N-[8-[3-(4-fluorophenyl)prop-2-enoylamino]octyl]prop-2-enamide (PubChem CID 5142775) has the molecular formula C26H30F2N2O2 and a molecular weight of 440.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[8-[3-(4-fluorophenyl)prop-2-enoylamino]octyl]prop-2-enamide.
| Compound Name | 3-(4-fluorophenyl)-N-[8-[3-(4-fluorophenyl)prop-2-enoylamino]octyl]prop-2-enamide |
|---|---|
| PubChem CID | 5142775 |
| Molecular Formula | C26H30F2N2O2 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[8-[3-(4-fluorophenyl)prop-2-enoylamino]octyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NCCCCCCCCNC(=O)C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H30F2N2O2/c27-23-13-7-21(8-14-23)11-17-25(31)29-19-5-3-1-2-4-6-20-30-26(32)18-12-22-9-15-24(28)16-10-22/h7-18H,1-6,19-20H2,(H,29,31)(H,30,32) |
| InChIKey | JSNOEISQZZGCJH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|