C12H12FNO — CID 6143200
(E)-3-(4-fluorophenyl)-N-prop-2-enylprop-2-enamide (PubChem CID 6143200) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 6143200 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCNC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNO/c1-2-9-14-12(15)8-5-10-3-6-11(13)7-4-10/h2-8H,1,9H2,(H,14,15)/b8-5+ |
| InChIKey | CHKIRRNBKWKPCQ-VMPITWQZSA-N |
| XLogP | 2.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|