C16H22N2O3S — CID 24641034
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide (PubChem CID 24641034) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 24641034 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCNC(=O)/C=C/c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C16H22N2O3S/c1-4-13-17-16(19)12-9-14-7-10-15(11-8-14)22(20,21)18(5-2)6-3/h4,7-12H,1,5-6,13H2,2-3H3,(H,17,19)/b12-9+ |
| InChIKey | QESUBAREQBMUSJ-FMIVXFBMSA-N |
| XLogP | 2.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|