C19H20F2N2O3S — CID 75618954
3-[4-(diethylsulfamoyl)phenyl]-N-(2,6-difluorophenyl)prop-2-enamide (PubChem CID 75618954) has the molecular formula C19H20F2N2O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-(2,6-difluorophenyl)prop-2-enamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(2,6-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75618954 |
| Molecular Formula | C19H20F2N2O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(2,6-difluorophenyl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C=CC(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C19H20F2N2O3S/c1-3-23(4-2)27(25,26)15-11-8-14(9-12-15)10-13-18(24)22-19-16(20)6-5-7-17(19)21/h5-13H,3-4H2,1-2H3,(H,22,24) |
| InChIKey | KYTNMBSVZGUDOY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|