C17H17F3N2O3S — CID 51158899
5-(diethylsulfamoyl)-N-(2,6-difluorophenyl)-2-fluorobenzamide (PubChem CID 51158899) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-(2,6-difluorophenyl)-2-fluorobenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-(2,6-difluorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 51158899 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-(2,6-difluorophenyl)-2-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C17H17F3N2O3S/c1-3-22(4-2)26(24,25)11-8-9-13(18)12(10-11)17(23)21-16-14(19)6-5-7-15(16)20/h5-10H,3-4H2,1-2H3,(H,21,23) |
| InChIKey | VLWDGKYHZQLTCZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |