C19H23ClFN3O3S — CID 55336223
N-[5-chloro-2-(dimethylamino)phenyl]-5-(diethylsulfamoyl)-2-fluorobenzamide (PubChem CID 55336223) has the molecular formula C19H23ClFN3O3S and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[5-chloro-2-(dimethylamino)phenyl]-5-(diethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-[5-chloro-2-(dimethylamino)phenyl]-5-(diethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 55336223 |
| Molecular Formula | C19H23ClFN3O3S |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[5-chloro-2-(dimethylamino)phenyl]-5-(diethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2cc(Cl)ccc2N(C)C)c1 |
| InChI | InChI=1S/C19H23ClFN3O3S/c1-5-24(6-2)28(26,27)14-8-9-16(21)15(12-14)19(25)22-17-11-13(20)7-10-18(17)23(3)4/h7-12H,5-6H2,1-4H3,(H,22,25) |
| InChIKey | FSZGOACYGLQJIA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |