C20H25FN2O3S — CID 26085905
5-(diethylsulfamoyl)-2-fluoro-N-(2,4,6-trimethylphenyl)benzamide (PubChem CID 26085905) has the molecular formula C20H25FN2O3S and a molecular weight of 392.50 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-fluoro-N-(2,4,6-trimethylphenyl)benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-fluoro-N-(2,4,6-trimethylphenyl)benzamide |
|---|---|
| PubChem CID | 26085905 |
| Molecular Formula | C20H25FN2O3S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-fluoro-N-(2,4,6-trimethylphenyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C20H25FN2O3S/c1-6-23(7-2)27(25,26)16-8-9-18(21)17(12-16)20(24)22-19-14(4)10-13(3)11-15(19)5/h8-12H,6-7H2,1-5H3,(H,22,24) |
| InChIKey | PRNRVFNEEWUJIZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |