C23H31FN2O3S — CID 26102432
5-(diethylsulfamoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-fluorobenzamide (PubChem CID 26102432) has the molecular formula C23H31FN2O3S and a molecular weight of 434.58 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-fluorobenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 26102432 |
| Molecular Formula | C23H31FN2O3S |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C23H31FN2O3S/c1-7-26(8-2)30(28,29)17-12-13-21(24)20(14-17)23(27)25-22-18(15(3)4)10-9-11-19(22)16(5)6/h9-16H,7-8H2,1-6H3,(H,25,27) |
| InChIKey | WCPRRVBRQMFXPD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |