C17H19BrFN3O3S — CID 30969614
5-bromo-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]-2-fluorobenzamide (PubChem CID 30969614) has the molecular formula C17H19BrFN3O3S and a molecular weight of 444.33 g/mol. Its IUPAC name is 5-bromo-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]-2-fluorobenzamide.
| Compound Name | 5-bromo-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 30969614 |
| Molecular Formula | C17H19BrFN3O3S |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 5-bromo-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]-2-fluorobenzamide |
| SMILES | CN(C)c1ccc(S(=O)(=O)N(C)C)cc1NC(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C17H19BrFN3O3S/c1-21(2)16-8-6-12(26(24,25)22(3)4)10-15(16)20-17(23)13-9-11(18)5-7-14(13)19/h5-10H,1-4H3,(H,20,23) |
| InChIKey | ZDNMFSZGIMKHKW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |