C18H22BrN3O3S2 — CID 25343529
2-(4-bromophenyl)sulfanyl-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 25343529) has the molecular formula C18H22BrN3O3S2 and a molecular weight of 472.43 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 25343529 |
| Molecular Formula | C18H22BrN3O3S2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)c1ccc(S(=O)(=O)N(C)C)cc1NC(=O)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H22BrN3O3S2/c1-21(2)17-10-9-15(27(24,25)22(3)4)11-16(17)20-18(23)12-26-14-7-5-13(19)6-8-14/h5-11H,12H2,1-4H3,(H,20,23) |
| InChIKey | AXWDKOCQBQHGAA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |