C18H20BrClN2O3S2 — CID 4549177
2-(4-bromophenyl)sulfanyl-N-[2-chloro-5-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 4549177) has the molecular formula C18H20BrClN2O3S2 and a molecular weight of 491.86 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-[2-chloro-5-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-[2-chloro-5-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4549177 |
| Molecular Formula | C18H20BrClN2O3S2 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-[2-chloro-5-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)CSc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C18H20BrClN2O3S2/c1-3-22(4-2)27(24,25)15-9-10-16(20)17(11-15)21-18(23)12-26-14-7-5-13(19)6-8-14/h5-11H,3-4,12H2,1-2H3,(H,21,23) |
| InChIKey | DWEAWSGFDXEGPR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |