C20H22Cl2N2O3S2 — CID 3471694
N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 3471694) has the molecular formula C20H22Cl2N2O3S2 and a molecular weight of 473.45 g/mol. Its IUPAC name is N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 3471694 |
| Molecular Formula | C20H22Cl2N2O3S2 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1cc(S(=O)(=O)N2CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O3S2/c21-15-5-7-16(8-6-15)28-14-20(25)23-19-13-17(9-10-18(19)22)29(26,27)24-11-3-1-2-4-12-24/h5-10,13H,1-4,11-12,14H2,(H,23,25) |
| InChIKey | BZYJWSKJPZUOIS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |