C14H17ClN6O3S2 — CID 4838513
N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 4838513) has the molecular formula C14H17ClN6O3S2 and a molecular weight of 416.92 g/mol. Its IUPAC name is N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4838513 |
| Molecular Formula | C14H17ClN6O3S2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cn1nnnc1SCC(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C14H17ClN6O3S2/c1-20-14(17-18-19-20)25-9-13(22)16-12-8-10(4-5-11(12)15)26(23,24)21-6-2-3-7-21/h4-5,8H,2-3,6-7,9H2,1H3,(H,16,22) |
| InChIKey | DVHHYULVNMNWIE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |