C15H19N5O3S2 — CID 8005917
2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-piperidin-1-ylsulfonylphenyl)ethanone (PubChem CID 8005917) has the molecular formula C15H19N5O3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-piperidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 8005917 |
| Molecular Formula | C15H19N5O3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
| SMILES | Cn1nnnc1SCC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C15H19N5O3S2/c1-19-15(16-17-18-19)24-11-14(21)12-5-7-13(8-6-12)25(22,23)20-9-3-2-4-10-20/h5-8H,2-4,9-11H2,1H3 |
| InChIKey | ICHKAGCVMSKQPN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |