C19H19N5O4S2 — CID 2485853
2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 2485853) has the molecular formula C19H19N5O4S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 2485853 |
| Molecular Formula | C19H19N5O4S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | O=C(CSc1nnnn1-c1ccc(O)cc1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H19N5O4S2/c25-16-7-5-15(6-8-16)24-19(20-21-22-24)29-13-18(26)14-3-9-17(10-4-14)30(27,28)23-11-1-2-12-23/h3-10,25H,1-2,11-13H2 |
| InChIKey | BRUIMAKVBRJRCI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |