C19H24N4O3S2 — CID 7876932
1-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone (PubChem CID 7876932) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone.
| Compound Name | 1-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 7876932 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-(4-pyrrolidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethanone |
| SMILES | O=C(CSc1nnc2n1CCCCC2)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H24N4O3S2/c24-17(14-27-19-21-20-18-6-2-1-3-13-23(18)19)15-7-9-16(10-8-15)28(25,26)22-11-4-5-12-22/h7-10H,1-6,11-14H2 |
| InChIKey | IYCOLHIGALRCOP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |