C20H27N5O3S2 — CID 4826675
N-(4-piperidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide (PubChem CID 4826675) has the molecular formula C20H27N5O3S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-(4-piperidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide.
| Compound Name | N-(4-piperidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 4826675 |
| Molecular Formula | C20H27N5O3S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(4-piperidin-1-ylsulfonylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2n1CCCCC2)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H27N5O3S2/c26-19(15-29-20-23-22-18-7-3-1-6-14-25(18)20)21-16-8-10-17(11-9-16)30(27,28)24-12-4-2-5-13-24/h8-11H,1-7,12-15H2,(H,21,26) |
| InChIKey | MFJMEMFKFFBBMA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |