C18H22N4O4S2 — CID 23876099
N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 23876099) has the molecular formula C18H22N4O4S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 23876099 |
| Molecular Formula | C18H22N4O4S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nccc(=O)[nH]1)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H22N4O4S2/c23-16-9-10-19-18(21-16)27-13-17(24)20-14-5-7-15(8-6-14)28(25,26)22-11-3-1-2-4-12-22/h5-10H,1-4,11-13H2,(H,20,24)(H,19,21,23) |
| InChIKey | NKCIYUBGWDYWBS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |