C16H24N2O3S2 — CID 2425954
2-(2-methylpropylsulfanyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 2425954) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-(2-methylpropylsulfanyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-methylpropylsulfanyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 2425954 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(2-methylpropylsulfanyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC(C)CSCC(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H24N2O3S2/c1-13(2)11-22-12-16(19)17-14-5-7-15(8-6-14)23(20,21)18-9-3-4-10-18/h5-8,13H,3-4,9-12H2,1-2H3,(H,17,19) |
| InChIKey | ZXCFQWYSBBMVJD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |