C14H18N2O5S — CID 28637929
methyl 3-oxo-3-(4-pyrrolidin-1-ylsulfonylanilino)propanoate (PubChem CID 28637929) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is methyl 3-oxo-3-(4-pyrrolidin-1-ylsulfonylanilino)propanoate.
| Compound Name | methyl 3-oxo-3-(4-pyrrolidin-1-ylsulfonylanilino)propanoate |
|---|---|
| PubChem CID | 28637929 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | methyl 3-oxo-3-(4-pyrrolidin-1-ylsulfonylanilino)propanoate |
| SMILES | COC(=O)CC(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C14H18N2O5S/c1-21-14(18)10-13(17)15-11-4-6-12(7-5-11)22(19,20)16-8-2-3-9-16/h4-7H,2-3,8-10H2,1H3,(H,15,17) |
| InChIKey | XDRPNTUBUWEPJO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|