C21H24N2O7S — CID 23961972
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-(4-methoxyphenoxy)acetate (PubChem CID 23961972) has the molecular formula C21H24N2O7S and a molecular weight of 448.50 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 23961972 |
| Molecular Formula | C21H24N2O7S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-(4-methoxyphenoxy)acetate |
| SMILES | COc1ccc(OCC(=O)OCC(=O)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O7S/c1-28-17-6-8-18(9-7-17)29-15-21(25)30-14-20(24)22-16-4-10-19(11-5-16)31(26,27)23-12-2-3-13-23/h4-11H,2-3,12-15H2,1H3,(H,22,24) |
| InChIKey | XOCGVQMCPLYPHI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |