C22H27N3O5S2 — CID 24816757
N-(4-methoxyphenyl)-2-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]sulfanylacetamide (PubChem CID 24816757) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]sulfanylacetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 24816757 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl]sulfanylacetamide |
| SMILES | COc1ccc(NC(=O)CSCC(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-30-19-9-5-17(6-10-19)23-21(26)15-31-16-22(27)24-18-7-11-20(12-8-18)32(28,29)25-13-3-2-4-14-25/h5-12H,2-4,13-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | USCGXGLGSNGEEH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |