C11H14N4O3S2 — CID 60801602
4-[5-(2-ethylsulfonylethylsulfanyl)tetrazol-1-yl]phenol (PubChem CID 60801602) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-[5-(2-ethylsulfonylethylsulfanyl)tetrazol-1-yl]phenol.
| Compound Name | 4-[5-(2-ethylsulfonylethylsulfanyl)tetrazol-1-yl]phenol |
|---|---|
| PubChem CID | 60801602 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4-[5-(2-ethylsulfonylethylsulfanyl)tetrazol-1-yl]phenol |
| SMILES | CCS(=O)(=O)CCSc1nnnn1-c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N4O3S2/c1-2-20(17,18)8-7-19-11-12-13-14-15(11)9-3-5-10(16)6-4-9/h3-6,16H,2,7-8H2,1H3 |
| InChIKey | GCROTHZIAMCNKT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |