C9H8F2N4OS — CID 54937608
4-[5-(2,2-difluoroethylsulfanyl)tetrazol-1-yl]phenol (PubChem CID 54937608) has the molecular formula C9H8F2N4OS and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-[5-(2,2-difluoroethylsulfanyl)tetrazol-1-yl]phenol.
| Compound Name | 4-[5-(2,2-difluoroethylsulfanyl)tetrazol-1-yl]phenol |
|---|---|
| PubChem CID | 54937608 |
| Molecular Formula | C9H8F2N4OS |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-[5-(2,2-difluoroethylsulfanyl)tetrazol-1-yl]phenol |
| SMILES | Oc1ccc(-n2nnnc2SCC(F)F)cc1 |
| InChI | InChI=1S/C9H8F2N4OS/c10-8(11)5-17-9-12-13-14-15(9)6-1-3-7(16)4-2-6/h1-4,8,16H,5H2 |
| InChIKey | BCBHPPBAHHFWKA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |