C11H14N6O2S — CID 63582154
3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-methylpropanehydrazide (PubChem CID 63582154) has the molecular formula C11H14N6O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-methylpropanehydrazide.
| Compound Name | 3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 63582154 |
| Molecular Formula | C11H14N6O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-2-methylpropanehydrazide |
| SMILES | CC(CSc1nnnn1-c1ccc(O)cc1)C(=O)NN |
| InChI | InChI=1S/C11H14N6O2S/c1-7(10(19)13-12)6-20-11-14-15-16-17(11)8-2-4-9(18)5-3-8/h2-5,7,18H,6,12H2,1H3,(H,13,19) |
| InChIKey | XHUCYENWGHJFKJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|