C11H13N5O2S — CID 41312485
(2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-methylpropanamide (PubChem CID 41312485) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-methylpropanamide.
| Compound Name | (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-methylpropanamide |
|---|---|
| PubChem CID | 41312485 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](C)Sc1nnnn1-c1ccc(O)cc1 |
| InChI | InChI=1S/C11H13N5O2S/c1-7(10(18)12-2)19-11-13-14-15-16(11)8-3-5-9(17)6-4-8/h3-7,17H,1-2H3,(H,12,18)/t7-/m0/s1 |
| InChIKey | AXPFUMUUQFLYEP-ZETCQYMHSA-N |
| XLogP | 0.59 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |