C21H24N6O2S — CID 18079085
2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 18079085) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 18079085 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | CC(Sc1nnnn1-c1ccc(O)cc1)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24N6O2S/c1-15(30-21-23-24-25-27(21)18-9-11-19(28)12-10-18)20(29)22-16-5-7-17(8-6-16)26-13-3-2-4-14-26/h5-12,15,28H,2-4,13-14H2,1H3,(H,22,29) |
| InChIKey | FGYPAFJMZXSXSS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|