C17H17N5O2S — CID 7474000
(2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methylphenyl)propanamide (PubChem CID 7474000) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methylphenyl)propanamide.
| Compound Name | (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 7474000 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (2S)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)Sc2nnnn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H17N5O2S/c1-11-3-5-13(6-4-11)18-16(24)12(2)25-17-19-20-21-22(17)14-7-9-15(23)10-8-14/h3-10,12,23H,1-2H3,(H,18,24)/t12-/m0/s1 |
| InChIKey | WQLDAPMXLQHKPL-LBPRGKRZSA-N |
| XLogP | 2.80 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |