C18H16N6OS — CID 9407792
(2R)-N-(4-cyanophenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 9407792) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is (2R)-N-(4-cyanophenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-(4-cyanophenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 9407792 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2R)-N-(4-cyanophenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | Cc1ccc(-n2nnnc2S[C@H](C)C(=O)Nc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C18H16N6OS/c1-12-3-9-16(10-4-12)24-18(21-22-23-24)26-13(2)17(25)20-15-7-5-14(11-19)6-8-15/h3-10,13H,1-2H3,(H,20,25)/t13-/m1/s1 |
| InChIKey | VVZLVMAYOYOZCL-CYBMUJFWSA-N |
| XLogP | 2.96 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |