C12H15N5OS — CID 41312479
(2S)-N-methyl-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 41312479) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is (2S)-N-methyl-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-methyl-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 41312479 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2S)-N-methyl-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CNC(=O)[C@H](C)Sc1nnnn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15N5OS/c1-8-4-6-10(7-5-8)17-12(14-15-16-17)19-9(2)11(18)13-3/h4-7,9H,1-3H3,(H,13,18)/t9-/m0/s1 |
| InChIKey | DRIQKLRLIQVDCR-VIFPVBQESA-N |
| XLogP | 1.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |