C13H16N6O3S — CID 16569702
2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(methylcarbamoyl)propanamide (PubChem CID 16569702) has the molecular formula C13H16N6O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 16569702 |
| Molecular Formula | C13H16N6O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)Sc1nnnn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H16N6O3S/c1-8(11(20)15-12(21)14-2)23-13-16-17-18-19(13)9-4-6-10(22-3)7-5-9/h4-8H,1-3H3,(H2,14,15,20,21) |
| InChIKey | IYIJWGBBDJZHKG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |