C18H16F3N5O3S — CID 24500522
N-(4-methoxyphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide (PubChem CID 24500522) has the molecular formula C18H16F3N5O3S and a molecular weight of 439.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(4-methoxyphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 24500522 |
| Molecular Formula | C18H16F3N5O3S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
| SMILES | COc1ccc(NC(=O)C(C)Sc2nnnn2-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H16F3N5O3S/c1-11(16(27)22-12-3-7-14(28-2)8-4-12)30-17-23-24-25-26(17)13-5-9-15(10-6-13)29-18(19,20)21/h3-11H,1-2H3,(H,22,27) |
| InChIKey | SPBASQMHGHBEOM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |