C14H16F3N5O2S — CID 9382473
(2S)-N-propyl-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide (PubChem CID 9382473) has the molecular formula C14H16F3N5O2S and a molecular weight of 375.38 g/mol. Its IUPAC name is (2S)-N-propyl-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-propyl-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 9382473 |
| Molecular Formula | C14H16F3N5O2S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (2S)-N-propyl-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CCCNC(=O)[C@H](C)Sc1nnnn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F3N5O2S/c1-3-8-18-12(23)9(2)25-13-19-20-21-22(13)10-4-6-11(7-5-10)24-14(15,16)17/h4-7,9H,3,8H2,1-2H3,(H,18,23)/t9-/m0/s1 |
| InChIKey | GGRIFPQQPIHCBF-VIFPVBQESA-N |
| XLogP | 2.57 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |