C11H10F3N5O2S — CID 8971274
(2R)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide (PubChem CID 8971274) has the molecular formula C11H10F3N5O2S and a molecular weight of 333.30 g/mol. Its IUPAC name is (2R)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2R)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 8971274 |
| Molecular Formula | C11H10F3N5O2S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (2R)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
| SMILES | C[C@@H](Sc1nnnn1-c1ccc(OC(F)(F)F)cc1)C(N)=O |
| InChI | InChI=1S/C11H10F3N5O2S/c1-6(9(15)20)22-10-16-17-18-19(10)7-2-4-8(5-3-7)21-11(12,13)14/h2-6H,1H3,(H2,15,20)/t6-/m1/s1 |
| InChIKey | XDCVCPCISGQPSA-ZCFIWIBFSA-N |
| XLogP | 1.53 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |