C15H18F3N5O2S — CID 24500527
N-(2-methylpropyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide (PubChem CID 24500527) has the molecular formula C15H18F3N5O2S and a molecular weight of 389.40 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(2-methylpropyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 24500527 |
| Molecular Formula | C15H18F3N5O2S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(2-methylpropyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(C)CNC(=O)C(C)Sc1nnnn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3N5O2S/c1-9(2)8-19-13(24)10(3)26-14-20-21-22-23(14)11-4-6-12(7-5-11)25-15(16,17)18/h4-7,9-10H,8H2,1-3H3,(H,19,24) |
| InChIKey | ITUMQESQUZPBAH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |