C18H18ClN5OS — CID 9462286
(2S)-N-(5-chloro-2-methylphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 9462286) has the molecular formula C18H18ClN5OS and a molecular weight of 387.90 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-methylphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-(5-chloro-2-methylphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 9462286 |
| Molecular Formula | C18H18ClN5OS |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (2S)-N-(5-chloro-2-methylphenyl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | Cc1ccc(-n2nnnc2S[C@@H](C)C(=O)Nc2cc(Cl)ccc2C)cc1 |
| InChI | InChI=1S/C18H18ClN5OS/c1-11-4-8-15(9-5-11)24-18(21-22-23-24)26-13(3)17(25)20-16-10-14(19)7-6-12(16)2/h4-10,13H,1-3H3,(H,20,25)/t13-/m0/s1 |
| InChIKey | XRGVRPDMFYEOFP-ZDUSSCGKSA-N |
| XLogP | 4.05 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |