C16H12Cl2FN5OS — CID 16535777
N-(2-chloro-4-fluorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 16535777) has the molecular formula C16H12Cl2FN5OS and a molecular weight of 412.28 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 16535777 |
| Molecular Formula | C16H12Cl2FN5OS |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1-c1ccc(Cl)cc1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H12Cl2FN5OS/c1-9(15(25)20-14-7-4-11(19)8-13(14)18)26-16-21-22-23-24(16)12-5-2-10(17)3-6-12/h2-9H,1H3,(H,20,25) |
| InChIKey | QMJUGFKSFOQTMG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |