C20H22ClN5OS — CID 7455244
(2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 7455244) has the molecular formula C20H22ClN5OS and a molecular weight of 415.95 g/mol. Its IUPAC name is (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7455244 |
| Molecular Formula | C20H22ClN5OS |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC[C@@H](C)c1ccccc1NC(=O)[C@H](C)Sc1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN5OS/c1-4-13(2)17-7-5-6-8-18(17)22-19(27)14(3)28-20-23-24-25-26(20)16-11-9-15(21)10-12-16/h5-14H,4H2,1-3H3,(H,22,27)/t13-,14+/m1/s1 |
| InChIKey | PXLPCFCUKCSMJP-KGLIPLIRSA-N |
| XLogP | 4.95 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |